4(1H)-Quinazolinone,3-butyl-2,3-dihydro-2-thioxo- structure
|
Common Name | 4(1H)-Quinazolinone,3-butyl-2,3-dihydro-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 13906-07-5 | Molecular Weight | 234.31700 | |
| Density | 1.25g/cm3 | Boiling Point | 362.7ºC at 760mmHg | |
| Molecular Formula | C12H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1ºC | |
| Name | 3-butyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760mmHg |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.31700 |
| Flash Point | 173.1ºC |
| Exact Mass | 234.08300 |
| PSA | 73.69000 |
| LogP | 2.48530 |
| Vapour Pressure | 1.9E-05mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | YIMVQTWMNLKAPM-UHFFFAOYSA-N |
| SMILES | CCCCn1c(=S)[nH]c2ccccc2c1=O |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-butyl-2-thioxo-2,3-dihydro-1H-quinazolin-4-one |
| 3-Butyl-2-mercapto-3H-quinazolin-4-one |
| 3-butyl-2-thioxo-2,3-dihydro-4(1H)-quinazolinone |
| 3-n-butyl-4-oxoquinazoline-2-thione |
| 3-butyl-2,3-dihydro-2-thioxoquinazolin-4(1H)-one |
| 3-butyl-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |