1-(2-chloroethyl)-3-naphthalen-2-yl-1-nitroso-urea structure
|
Common Name | 1-(2-chloroethyl)-3-naphthalen-2-yl-1-nitroso-urea | ||
|---|---|---|---|---|
| CAS Number | 13907-53-4 | Molecular Weight | 277.70600 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-3-naphthalen-2-yl-1-nitrosourea |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.70600 |
| Exact Mass | 277.06200 |
| PSA | 61.77000 |
| LogP | 3.66690 |
| Index of Refraction | 1.623 |
| InChIKey | ROTOWMSDOZXALA-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)Nc1ccc2ccccc2c1 |
|
~%
1-(2-chloroethy... CAS#:13907-53-4 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
|
~%
1-(2-chloroethy... CAS#:13907-53-4 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |