Urea, 1,1-o-phenylenebis[3- (2-chloroethyl)-3-nitroso- structure
|
Common Name | Urea, 1,1-o-phenylenebis[3- (2-chloroethyl)-3-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 13907-58-9 | Molecular Weight | 377.18300 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14Cl2N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-3-[2-[[2-chloroethyl(nitroso)carbamoyl]amino]phenyl]-1-nitrosourea |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C12H14Cl2N6O4 |
| Molecular Weight | 377.18300 |
| Exact Mass | 376.04500 |
| PSA | 123.54000 |
| LogP | 3.34080 |
| Index of Refraction | 1.636 |
| InChIKey | ODFNKHASETVMLH-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)Nc1ccccc1NC(=O)N(CCCl)N=O |
|
~%
Urea, 1,1-o-phe... CAS#:13907-58-9 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |