1-(3-chloropropyl)-1-nitroso-3-phenyl-urea structure
|
Common Name | 1-(3-chloropropyl)-1-nitroso-3-phenyl-urea | ||
|---|---|---|---|---|
| CAS Number | 13907-69-2 | Molecular Weight | 241.67400 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-chloropropyl)-1-nitroso-3-phenylurea |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.67400 |
| Exact Mass | 241.06200 |
| PSA | 61.77000 |
| LogP | 2.90380 |
| Index of Refraction | 1.574 |
| InChIKey | SFFTUPVXQAEVAV-UHFFFAOYSA-N |
| SMILES | O=NN(CCCCl)C(=O)Nc1ccccc1 |
|
~%
1-(3-chloroprop... CAS#:13907-69-2 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |