1-methyl-3-[4-(methylcarbamoylamino)cyclohexyl]urea structure
|
Common Name | 1-methyl-3-[4-(methylcarbamoylamino)cyclohexyl]urea | ||
|---|---|---|---|---|
| CAS Number | 13907-74-9 | Molecular Weight | 228.29100 | |
| Density | 1.13g/cm3 | Boiling Point | 523.6ºC at 760 mmHg | |
| Molecular Formula | C10H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2ºC | |
| Name | 1-methyl-3-[4-(methylcarbamoylamino)cyclohexyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 523.6ºC at 760 mmHg |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.29100 |
| Flash Point | 221.2ºC |
| Exact Mass | 228.15900 |
| PSA | 82.26000 |
| LogP | 1.71920 |
| Vapour Pressure | 4.65E-11mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | AVIOYRMXTIRJRV-UHFFFAOYSA-N |
| SMILES | CNC(=O)NC1CCC(NC(=O)NC)CC1 |
|
~%
1-methyl-3-[4-(... CAS#:13907-74-9 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1'-cyclohexane-1,4-diylbis(3-methylurea) |
| 1,1'-(trans-1,4-Cyclohexylene)bis(3-methylurea) |