1-(2-fluoroethyl)-3-[4-(2-fluoroethylcarbamoylamino)phenyl]urea structure
|
Common Name | 1-(2-fluoroethyl)-3-[4-(2-fluoroethylcarbamoylamino)phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 13907-99-8 | Molecular Weight | 286.27800 | |
| Density | 1.318g/cm3 | Boiling Point | 403ºC at 760 mmHg | |
| Molecular Formula | C12H16F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.6ºC | |
| Name | 1-(2-fluoroethyl)-3-[4-(2-fluoroethylcarbamoylamino)phenyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 403ºC at 760 mmHg |
| Molecular Formula | C12H16F2N4O2 |
| Molecular Weight | 286.27800 |
| Flash Point | 197.6ºC |
| Exact Mass | 286.12400 |
| PSA | 82.26000 |
| LogP | 2.79640 |
| Vapour Pressure | 1.05E-06mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | NNUOIMVEXIIHOI-UHFFFAOYSA-N |
| SMILES | O=C(NCCF)Nc1ccc(NC(=O)NCCF)cc1 |
|
~%
1-(2-fluoroethy... CAS#:13907-99-8 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1'-benzene-1,4-diylbis[3-(2-fluoroethyl)urea] |
| 1,1'-p-Phenylenebis<3-(2-fluoroethyl)urea> |