ethyl 1-(2-chloroethylcarbamoylamino)cyclopentane-1-carboxylate structure
|
Common Name | ethyl 1-(2-chloroethylcarbamoylamino)cyclopentane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 13908-10-6 | Molecular Weight | 262.73300 | |
| Density | 1.19g/cm3 | Boiling Point | 424.1ºC at 760 mmHg | |
| Molecular Formula | C11H19ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | ethyl 1-(2-chloroethylcarbamoylamino)cyclopentane-1-carboxylate |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 424.1ºC at 760 mmHg |
| Molecular Formula | C11H19ClN2O3 |
| Molecular Weight | 262.73300 |
| Flash Point | 210.3ºC |
| Exact Mass | 262.10800 |
| PSA | 67.43000 |
| LogP | 2.18210 |
| Vapour Pressure | 2.13E-07mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | QWGPMPXWQYWXRD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(NC(=O)NCCCl)CCCC1 |
|
~%
ethyl 1-(2-chlo... CAS#:13908-10-6 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |