ethyl 4-(2-chloroethylcarbamoylamino)cyclohexane-1-carboxylate structure
|
Common Name | ethyl 4-(2-chloroethylcarbamoylamino)cyclohexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 13908-22-0 | Molecular Weight | 276.76000 | |
| Density | 1.16g/cm3 | Boiling Point | 442.5ºC at 760mmHg | |
| Molecular Formula | C12H21ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.4ºC | |
| Name | ethyl 4-(2-chloroethylcarbamoylamino)cyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 442.5ºC at 760mmHg |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76000 |
| Flash Point | 221.4ºC |
| Exact Mass | 276.12400 |
| PSA | 70.92000 |
| LogP | 2.24160 |
| Vapour Pressure | 5.02E-08mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | KTMFDGZEPONSKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(NC(=O)NCCCl)CC1 |
|
~%
ethyl 4-(2-chlo... CAS#:13908-22-0 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ethyl 4-{[(2-chloroethyl)carbamoyl]amino}cyclohexanecarboxylate |