1-(2-chloroethyl)-3-[(1S,2R,4S)-4,7,7-trimethyl-3-oxo-norbornan-2-yl]urea structure
|
Common Name | 1-(2-chloroethyl)-3-[(1S,2R,4S)-4,7,7-trimethyl-3-oxo-norbornan-2-yl]urea | ||
|---|---|---|---|---|
| CAS Number | 13908-26-4 | Molecular Weight | 272.77100 | |
| Density | 1.19g/cm3 | Boiling Point | 443.1ºC at 760 mmHg | |
| Molecular Formula | C13H21ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.8ºC | |
| Name | 1-(2-chloroethyl)-3-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)urea |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 443.1ºC at 760 mmHg |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.77100 |
| Flash Point | 221.8ºC |
| Exact Mass | 272.12900 |
| PSA | 58.20000 |
| LogP | 2.70000 |
| Vapour Pressure | 4.75E-08mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | WVSMMTGLYQFYDC-JRKPZEMJSA-N |
| SMILES | CC12CCC(C(NC(=O)NCCCl)C1=O)C2(C)C |
|
~%
1-(2-chloroethy... CAS#:13908-26-4 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |