1-(2-chloroethyl)-3-(3-nitrophenyl)urea structure
|
Common Name | 1-(2-chloroethyl)-3-(3-nitrophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 13908-41-3 | Molecular Weight | 243.64700 | |
| Density | 1.424g/cm3 | Boiling Point | 363.6ºC at 760 mmHg | |
| Molecular Formula | C9H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | 1-(2-chloroethyl)-3-(3-nitrophenyl)urea |
|---|
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 363.6ºC at 760 mmHg |
| Molecular Formula | C9H10ClN3O3 |
| Molecular Weight | 243.64700 |
| Flash Point | 173.7ºC |
| Exact Mass | 243.04100 |
| PSA | 86.95000 |
| LogP | 2.94220 |
| Vapour Pressure | 1.79E-05mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | IZXPMGXAUUALNM-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)Nc1cccc([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |