Benzoic acid,4-[[[(2-chloroethyl)amino]carbonyl]amino]- structure
|
Common Name | Benzoic acid,4-[[[(2-chloroethyl)amino]carbonyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 13908-46-8 | Molecular Weight | 242.65900 | |
| Density | 1.412g/cm3 | Boiling Point | 409.2ºC at 760 mmHg | |
| Molecular Formula | C10H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | 4-(3-(2-chloroethyl)ureido)benzoic acid |
|---|
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760 mmHg |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.65900 |
| Flash Point | 201.2ºC |
| Exact Mass | 242.04600 |
| PSA | 78.43000 |
| LogP | 2.20900 |
| Vapour Pressure | 1.99E-07mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | QXPXBJOWVUHUCM-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)Nc1ccc(C(=O)O)cc1 |
|
~%
Benzoic acid,4-... CAS#:13908-46-8 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |