Benzoic acid,4-[[[(2-chloroethyl)amino]carbonyl]amino]-, ethyl ester structure
|
Common Name | Benzoic acid,4-[[[(2-chloroethyl)amino]carbonyl]amino]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 13908-47-9 | Molecular Weight | 270.71200 | |
| Density | 1.267g/cm3 | Boiling Point | 387ºC at 760mmHg | |
| Molecular Formula | C12H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9ºC | |
| Name | ethyl 4-(2-chloroethylcarbamoylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 387ºC at 760mmHg |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.71200 |
| Flash Point | 187.9ºC |
| Exact Mass | 270.07700 |
| PSA | 67.43000 |
| LogP | 2.68750 |
| Vapour Pressure | 3.39E-06mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | YIMUQFZYIRNHBM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)NCCCl)cc1 |
|
~%
Benzoic acid,4-... CAS#:13908-47-9 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| ethyl 4-{[(2-chloroethyl)carbamoyl]amino}benzoate |