Benzamide,4-[[[(2-chloroethyl)amino]carbonyl]amino]-N,N-dimethyl- structure
|
Common Name | Benzamide,4-[[[(2-chloroethyl)amino]carbonyl]amino]-N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 13908-49-1 | Molecular Weight | 269.72700 | |
| Density | 1.257g/cm3 | Boiling Point | 427.9ºC at 760 mmHg | |
| Molecular Formula | C12H16ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6ºC | |
| Name | 4-(2-chloroethylcarbamoylamino)-N,N-dimethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 427.9ºC at 760 mmHg |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.72700 |
| Flash Point | 212.6ºC |
| Exact Mass | 269.09300 |
| PSA | 61.44000 |
| LogP | 2.21260 |
| Vapour Pressure | 1.58E-07mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | ZGLCEZMUTDVHOD-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)NCCCl)cc1 |
|
~%
Benzamide,4-[[[... CAS#:13908-49-1 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
|
~%
Benzamide,4-[[[... CAS#:13908-49-1 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Urea,1-(2-chloroethyl)-3-[p-(dimethylcarbamoyl)phenyl] |
| 4-{[(2-chloroethyl)carbamoyl]amino}-n,n-dimethylbenzamide |