2-[4-(2-chloroethylcarbamoylamino)phenyl]acetic acid structure
|
Common Name | 2-[4-(2-chloroethylcarbamoylamino)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 13908-53-7 | Molecular Weight | 256.68600 | |
| Density | 1.375g/cm3 | Boiling Point | 425ºC at 760 mmHg | |
| Molecular Formula | C11H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.8ºC | |
| Name | cmlwfcuaxgsmbb-uhfffaoysa |
|---|
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760 mmHg |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.68600 |
| Flash Point | 210.8ºC |
| Exact Mass | 256.06100 |
| PSA | 78.43000 |
| LogP | 2.13790 |
| Vapour Pressure | 5.58E-08mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | AFIDABFWFCTLLC-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc(NC(=O)NCCCl)cc1 |
|
~%
2-[4-(2-chloroe... CAS#:13908-53-7 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |