1-(2-chloroethyl)-3-[4-(2-chloroethylcarbamoylamino)phenyl]urea structure
|
Common Name | 1-(2-chloroethyl)-3-[4-(2-chloroethylcarbamoylamino)phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 13908-69-5 | Molecular Weight | 319.18700 | |
| Density | 1.393g/cm3 | Boiling Point | 446.6ºC at 760 mmHg | |
| Molecular Formula | C12H16Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
| Name | 1-(2-chloroethyl)-3-[4-(2-chloroethylcarbamoylamino)phenyl]urea |
|---|
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 446.6ºC at 760 mmHg |
| Molecular Formula | C12H16Cl2N4O2 |
| Molecular Weight | 319.18700 |
| Flash Point | 223.9ºC |
| Exact Mass | 318.06500 |
| PSA | 82.26000 |
| LogP | 3.33500 |
| Vapour Pressure | 3.61E-08mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | JWHWQBGXRFLSGK-UHFFFAOYSA-N |
| SMILES | O=C(NCCCl)Nc1ccc(NC(=O)NCCCl)cc1 |
|
~%
1-(2-chloroethy... CAS#:13908-69-5 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |