1,3-bis(2-chlorocyclohexyl)urea structure
|
Common Name | 1,3-bis(2-chlorocyclohexyl)urea | ||
|---|---|---|---|---|
| CAS Number | 13908-80-0 | Molecular Weight | 293.23300 | |
| Density | 1.2g/cm3 | Boiling Point | 494.4ºC at 760mmHg | |
| Molecular Formula | C13H22Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8ºC | |
| Name | 1,3-bis(2-chlorocyclohexyl)urea |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 494.4ºC at 760mmHg |
| Molecular Formula | C13H22Cl2N2O |
| Molecular Weight | 293.23300 |
| Flash Point | 252.8ºC |
| Exact Mass | 292.11100 |
| PSA | 41.13000 |
| LogP | 4.16740 |
| Vapour Pressure | 6.45E-10mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | HEBOXYNUDXBKBC-UHFFFAOYSA-N |
| SMILES | O=C(NC1CCCCC1Cl)NC1CCCCC1Cl |
|
~%
1,3-bis(2-chlor... CAS#:13908-80-0 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |