Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]
Modify Date: 2026-08-08 23:26:30
![Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] Structure](https://www.chemsrc.com/extcaspic/307/1390828-89-3.png)
Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] structure
|
Common Name | Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 1390828-89-3 | Molecular Weight | 404.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H24N4O3 |
|---|---|
| Molecular Weight | 404.5 |
| InChIKey | BQJIFIBPYNAUJF-UHFFFAOYSA-N |
| SMILES | COc1ccccc1CN(CCO)C(=O)Nc1ccc(N=Nc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1390828-89-3? |
| A: Chinese name of 1390828-89-3 is 1390828-89-3. |
| Q: What is the molecular formula of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: Molecular formula of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] is C23H24N4O3. |
| Q: What is the InChIKey of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: InChIKey of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] is BQJIFIBPYNAUJF-UHFFFAOYSA-N. |
| Q: What is the English name of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: The English name of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] is Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]. |
| Q: What is the SMILES notation of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: SMILES notation of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] is COc1ccccc1CN(CCO)C(=O)Nc1ccc(N=Nc2ccccc2)cc1. |
| Q: What is the CAS number of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: CAS number of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] is 1390828-89-3. |
| Q: What is the molecular weight of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: Molecular weight of Urea, N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]-N'-[4-(2-phenyldiazenyl)phenyl] is 404.5. |