1-(2-chloroethyl)-3-(4-cyanophenyl)-1-nitroso-urea structure
|
Common Name | 1-(2-chloroethyl)-3-(4-cyanophenyl)-1-nitroso-urea | ||
|---|---|---|---|---|
| CAS Number | 13909-22-3 | Molecular Weight | 252.65700 | |
| Density | 1.35g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-3-(4-cyanophenyl)-1-nitrosourea |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.65700 |
| Exact Mass | 252.04100 |
| PSA | 85.56000 |
| LogP | 2.38538 |
| Index of Refraction | 1.608 |
| InChIKey | SVOUVWBMNXWYOV-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(NC(=O)N(CCCl)N=O)cc1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|