2-[(2-chloroethyl-nitroso-carbamoyl)amino]benzoic acid
![2-[(2-chloroethyl-nitroso-carbamoyl)amino]benzoic acid Structure](https://image.chemsrc.com/caspic/025/13909-23-4.png)
2-[(2-chloroethyl-nitroso-carbamoyl)amino]benzoic acid structure
|
Common Name | 2-[(2-chloroethyl-nitroso-carbamoyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 13909-23-4 | Molecular Weight | 271.65700 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-[(2-Chloroethyl-nitroso-carbamoyl)amino]benzoic acid, also known as 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid, with CAS number 13909-23-4, molecular formula C10H10ClN3O4, and molecular weight 271.66. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.65700 |
| Exact Mass | 271.03600 |
| PSA | 99.07000 |
| LogP | 2.21190 |
| Index of Refraction | 1.615 |
| InChIKey | IRVKQMQRPACWDV-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)Nc1ccccc1C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:118-92-3![Benzoic acid,2-[[[(2-chloroethyl)amino]carbonyl]amino] Structure](https://image.chemsrc.com/caspic/419/13908-44-6.png)
CAS#:13908-44-6This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: InChIKey of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is IRVKQMQRPACWDV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: Molecular formula of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is C10H10ClN3O4. |
| Q: What is the CAS number of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: CAS number of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is 13909-23-4. |
| Q: What is the molecular weight of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: Molecular weight of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is 271.65700. |
| Q: What are the upstream materials of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: Related upstream materials(CAS) of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid: 118-92-3;13908-44-6. |
| Q: What is the LogP of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: LogP of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is 2.21190. |
| Q: What is the English name of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: The English name of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid. |
| Q: What is the polar surface area (PSA) of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: Polar surface area (PSA) of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is 99.07000. |
| Q: What is the SMILES notation of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid? |
| A: SMILES notation of 2-[[2-chloroethyl(nitroso)carbamoyl]amino]benzoic acid is O=NN(CCCl)C(=O)Nc1ccccc1C(=O)O. |
| Q: What is the Chinese name of 13909-23-4? |
| A: Chinese name of 13909-23-4 is 13909-23-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |