Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]
Modify Date: 2025-08-27 07:42:28
![Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] Structure](https://www.chemsrc.com/extcaspic/116/1390956-22-5.png)
Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] structure
|
Common Name | Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 1390956-22-5 | Molecular Weight | 360.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H20N4O2 |
|---|---|
| Molecular Weight | 360.4 |
| InChIKey | UQERXMKOXGYZGC-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccccc1O)C(=O)Nc1ccc(N=Nc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: CAS number of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] is 1390956-22-5. |
| Q: What is the English name of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: The English name of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] is Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]. |
| Q: What is the InChIKey of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: InChIKey of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] is UQERXMKOXGYZGC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1390956-22-5? |
| A: Chinese name of 1390956-22-5 is 1390956-22-5. |
| Q: What is the molecular formula of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: Molecular formula of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] is C21H20N4O2. |
| Q: What is the molecular weight of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: Molecular weight of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] is 360.4. |
| Q: What is the SMILES notation of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl]? |
| A: SMILES notation of Urea, N-[(2-hydroxyphenyl)methyl]-N-methyl-N'-[4-(2-phenyldiazenyl)phenyl] is CN(Cc1ccccc1O)C(=O)Nc1ccc(N=Nc2ccccc2)cc1. |