3-Amino-4-(3,4-dichlorophenyl)butyric Acid
Modify Date: 2025-11-02 11:27:52
3-Amino-4-(3,4-dichlorophenyl)butyric Acid structure
|
Common Name | 3-Amino-4-(3,4-dichlorophenyl)butyric Acid | ||
|---|---|---|---|---|
| CAS Number | 1391092-75-3 | Molecular Weight | 248.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-4-(3,4-dichlorophenyl)butyric Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11Cl2NO2 |
|---|---|
| Molecular Weight | 248.10 |
| InChIKey | MVUQWYZNNRALPX-UHFFFAOYSA-N |
| SMILES | NC(CC(=O)O)Cc1ccc(Cl)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid? |
| A: InChIKey of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid is MVUQWYZNNRALPX-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid? |
| A: The English name of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid is 3-Amino-4-(3,4-dichlorophenyl)butyric Acid. |
| Q: What is the CAS number of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid? |
| A: CAS number of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid is 1391092-75-3. |
| Q: What is the molecular formula of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid? |
| A: Molecular formula of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid is C10H11Cl2NO2. |
| Q: What is the molecular weight of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid? |
| A: Molecular weight of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid is 248.10. |
| Q: What is the SMILES notation of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid? |
| A: SMILES notation of 3-Amino-4-(3,4-dichlorophenyl)butyric Acid is NC(CC(=O)O)Cc1ccc(Cl)c(Cl)c1. |
| Q: What is the Chinese name of 1391092-75-3? |
| A: Chinese name of 1391092-75-3 is 1391092-75-3. |