(S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl
Modify Date: 2025-09-10 01:19:58
(S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl structure
|
Common Name | (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl | ||
|---|---|---|---|---|
| CAS Number | 1391576-28-5 | Molecular Weight | 301.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17ClFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17ClFNO3 |
|---|---|
| Molecular Weight | 301.74 |
| InChIKey | RJMDRRCHYNICAQ-ZOWNYOTGSA-N |
| SMILES | COC(=O)C(c1ccc(F)cc1)N1CCC(=O)CC1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1391576-28-5? |
| A: Chinese name of 1391576-28-5 is 1391576-28-5. |
| Q: What is the English name of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl? |
| A: The English name of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl is (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl. |
| Q: What is the molecular weight of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl? |
| A: Molecular weight of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl is 301.74. |
| Q: What is the CAS number of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl? |
| A: CAS number of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl is 1391576-28-5. |
| Q: What is the SMILES notation of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl? |
| A: SMILES notation of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl is COC(=O)C(c1ccc(F)cc1)N1CCC(=O)CC1.Cl. |
| Q: What is the InChIKey of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl? |
| A: InChIKey of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl is RJMDRRCHYNICAQ-ZOWNYOTGSA-N. |
| Q: What is the molecular formula of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl? |
| A: Molecular formula of (S)-Methyl (4-fluorophenyl)-(4-oxo-1-piperidinyl)acetate hcl is C14H17ClFNO3. |