4-Ethyl-4'-(3,4,5-trifluorophenyl)bi(cyclohexane) structure
|
Common Name | 4-Ethyl-4'-(3,4,5-trifluorophenyl)bi(cyclohexane) | ||
|---|---|---|---|---|
| CAS Number | 139215-80-8 | Molecular Weight | 324.424 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 366.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C20H27F3 | Melting Point | 73 °C | |
| MSDS | N/A | Flash Point | 202.0±17.7 °C | |
| Name | 5-[4-(4-ethylcyclohexyl)cyclohexyl]-1,2,3-trifluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.1±42.0 °C at 760 mmHg |
| Melting Point | 73 °C |
| Molecular Formula | C20H27F3 |
| Molecular Weight | 324.424 |
| Flash Point | 202.0±17.7 °C |
| Exact Mass | 324.206482 |
| LogP | 8.33 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | DXFHMMVZUZLQFU-UHFFFAOYSA-N |
| SMILES | CCC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-ethyl-4'-(3,4,5-trifluorophenyl)bi(cyclohexane) |
| (1r,4r)-4-Ethyl-4'-(3,4,5-trifluorophenyl)-1,1'-bi(cyclohexyl) |
| (1R,4R)-4-ethyl-4'-(3,4,5-trifluorophenyl)-1,1'-bi(cyclohexane) |
| Benzene, 5-(4'-ethyl[1,1'-bicyclohexyl]-4-yl)-1,2,3-trifluoro- |
| BENZENE,5-[(TRANS,TRANS)-4'-ETHYL[1,1'-BICYCLOHEXYL]-4-YL]-1,2,3-TRIFLUORO |