1-[3-(Benzyloxy)phenyl]-2-methyl-2-propen-1-one structure
|
Common Name | 1-[3-(Benzyloxy)phenyl]-2-methyl-2-propen-1-one | ||
|---|---|---|---|---|
| CAS Number | 1392210-34-2 | Molecular Weight | 252.308 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 397.6±34.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.6±19.2 °C | |
| Name | 2-methyl-1-(3-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.6±34.0 °C at 760 mmHg |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.308 |
| Flash Point | 174.6±19.2 °C |
| Exact Mass | 252.115036 |
| PSA | 26.30000 |
| LogP | 4.25 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | JEKRJEOQJYLFRR-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)c1cccc(OCc2ccccc2)c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Propen-1-one, 2-methyl-1-[3-(phenylmethoxy)phenyl]- |
| 1-[3-(Benzyloxy)phenyl]-2-methyl-2-propen-1-one |
| 1-(3-(Benzyloxy)phenyl)-2-methylprop-2-en-1-one |