1-(4-ethylbenzoyl)-2-t-butyl hydrazine
Modify Date: 2025-10-13 23:50:43
1-(4-ethylbenzoyl)-2-t-butyl hydrazine structure
|
Common Name | 1-(4-ethylbenzoyl)-2-t-butyl hydrazine | ||
|---|---|---|---|---|
| CAS Number | 139303-74-5 | Molecular Weight | 220.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-ethylbenzoyl)-2-t-butyl hydrazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20N2O |
|---|---|
| Molecular Weight | 220.31100 |
| Exact Mass | 220.15800 |
| PSA | 41.13000 |
| LogP | 3.06370 |
| InChIKey | YKWLOFDSMMILOG-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)NNC(C)(C)C)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(4-Ethylbenzoyl)-2-t-butylhydrazine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: The English name of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is 1-(4-ethylbenzoyl)-2-t-butyl hydrazine. |
| Q: What is the polar surface area (PSA) of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: Polar surface area (PSA) of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is 41.13000. |
| Q: What is the CAS number of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: CAS number of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is 139303-74-5. |
| Q: What English synonyms does 1-(4-ethylbenzoyl)-2-t-butyl hydrazine have? |
| A: English synonyms of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine: 1-(4-Ethylbenzoyl)-2-t-butylhydrazine. |
| Q: What is the InChIKey of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: InChIKey of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is YKWLOFDSMMILOG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: Molecular formula of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is C13H20N2O. |
| Q: What is the Chinese name of 139303-74-5? |
| A: Chinese name of 139303-74-5 is 139303-74-5. |
| Q: What is the SMILES notation of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: SMILES notation of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is CCc1ccc(C(=O)NNC(C)(C)C)cc1. |
| Q: What is the LogP of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: LogP of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is 3.06370. |
| Q: What is the molecular weight of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine? |
| A: Molecular weight of 1-(4-ethylbenzoyl)-2-t-butyl hydrazine is 220.31100. |