Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine
Modify Date: 2026-09-27 09:58:20
Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine structure
|
Common Name | Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 1393473-88-5 | Molecular Weight | 446.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18N10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H18N10 |
|---|---|
| Molecular Weight | 446.5 |
| InChIKey | PRBKFNCLEBOHQA-UHFFFAOYSA-N |
| SMILES | c1ncn(-c2ccc(N(c3ccc(-n4cncn4)cc3)c3ccc(-n4cncn4)cc3)cc2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine? |
| A: The English name of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine is Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine. |
| Q: What is the CAS number of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine? |
| A: CAS number of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine is 1393473-88-5. |
| Q: What is the InChIKey of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine? |
| A: InChIKey of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine is PRBKFNCLEBOHQA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1393473-88-5? |
| A: Chinese name of 1393473-88-5 is 1393473-88-5. |
| Q: What is the molecular formula of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine? |
| A: Molecular formula of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine is C24H18N10. |
| Q: What is the SMILES notation of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine? |
| A: SMILES notation of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine is c1ncn(-c2ccc(N(c3ccc(-n4cncn4)cc3)c3ccc(-n4cncn4)cc3)cc2)n1. |
| Q: What is the molecular weight of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine? |
| A: Molecular weight of Tris(4-(1H-1,2,4-triazol-1-yl)phenyl)amine is 446.5. |