5-Cyanotryptophan structure
|
Common Name | 5-Cyanotryptophan | ||
|---|---|---|---|---|
| CAS Number | 139393-02-5 | Molecular Weight | 229.235 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 524.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.0±30.1 °C | |
| Name | 2-amino-3-(5-cyano-1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 524.5±50.0 °C at 760 mmHg |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.235 |
| Flash Point | 271.0±30.1 °C |
| Exact Mass | 229.085129 |
| PSA | 102.90000 |
| LogP | 1.25 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | RWUVZHFIVNNDBO-JTQLQIEISA-N |
| SMILES | N#Cc1ccc2[nH]cc(CC(N)C(=O)O)c2c1 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-CYANO-DL-TRYPTOPHAN |
| 5-Cyanotryptophan |
| 5-Cyano-L-tryptophan |
| C-8990 |
| Tryptophan, 5-cyano- |