1-Propyl-1-[2-(2,4,6-trichlorophenoxy)ethyl]urea structure
|
Common Name | 1-Propyl-1-[2-(2,4,6-trichlorophenoxy)ethyl]urea | ||
|---|---|---|---|---|
| CAS Number | 139520-94-8 | Molecular Weight | 325.619 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 440.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C12H15Cl3N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 220.4±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-propyl-1-[2-(2,4,6-trichlorophenoxy)ethyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.8±55.0 °C at 760 mmHg |
| Molecular Formula | C12H15Cl3N2O2 |
| Molecular Weight | 325.619 |
| Flash Point | 220.4±31.5 °C |
| Exact Mass | 324.019897 |
| PSA | 56.55000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | MPNJTIZLDHWBFX-UHFFFAOYSA-N |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(N)=O |
| Storage condition | -20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| Urea,N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl] |
| 1-Propyl-1-[2-(2,4,6-trichlorophenoxy)ethyl]urea |
| Urea, N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]- |
| 4G-902 |