6-methyl-4-phenyl-1H-quinazolin-2-one structure
|
Common Name | 6-methyl-4-phenyl-1H-quinazolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 13961-64-3 | Molecular Weight | 236.26900 | |
| Density | 1.21g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-4-phenyl-1H-quinazolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.26900 |
| Exact Mass | 236.09500 |
| PSA | 46.01000 |
| LogP | 3.31080 |
| Index of Refraction | 1.648 |
| InChIKey | ULRSRGDZNASHQP-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c(=O)nc(-c3ccccc3)c2c1 |
| HS Code | 2933990090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2(1H)-Quinazolinone,6-methyl-4-phenyl |
| 6-Methyl-4-phenyl-1H-chinazolin-2-on |
| 6-Methyl-4-phenyl-2(1H)-quinazolinone |
| 4-Phenyl-6-methyl-2(1H)-quinazolinone |
| 4-Phenyl-6-methyl-chinazolinon |
| 6-methyl-4-phenylquinazolin-2(1H)-one |
| F0016-1218 |