4-(PERFLUOROHEXYL)ANILINE
4-(PERFLUOROHEXYL)ANILINE structure
|
Common Name | 4-(PERFLUOROHEXYL)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 139613-90-4 | Molecular Weight | 411.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6F13N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H6F13N |
|---|---|
| Molecular Weight | 411.16200 |
| Exact Mass | 411.02900 |
| PSA | 26.02000 |
| LogP | 6.04530 |
| InChIKey | OQIGJIYYJLAXJO-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2921420090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-perfluorohexylbenzenamine |
| Benzenamine,4-(tridecafluorohexyl) |
| 4-(PERFLUOROHEXYL)ANILINE |
| 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenylamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: Polar surface area (PSA) of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is 26.02000. |
| Q: What is the CAS number of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: CAS number of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is 139613-90-4. |
| Q: What English synonyms does 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline have? |
| A: English synonyms of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline: 4-perfluorohexylbenzenamine, Benzenamine,4-(tridecafluorohexyl), 4-(PERFLUOROHEXYL)ANILINE, 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenylamine. |
| Q: What is the InChIKey of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: InChIKey of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is OQIGJIYYJLAXJO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: SMILES notation of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is Nc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1. |
| Q: What is the LogP of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: LogP of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is 6.04530. |
| Q: What is the molecular formula of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: Molecular formula of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is C12H6F13N. |
| Q: What is the English name of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: The English name of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline. |
| Q: What is the molecular weight of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline? |
| A: Molecular weight of 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline is 411.16200. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |