3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide
Modify Date: 2026-09-20 08:15:18
3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide structure
|
Common Name | 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 1396876-60-0 | Molecular Weight | 359.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19F2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19F2N3O2 |
|---|---|
| Molecular Weight | 359.4 |
| InChIKey | RTXYUBVURPPLHO-UHFFFAOYSA-N |
| SMILES | O=C(NCC1CCN(C(=O)c2ccncc2)CC1)c1ccc(F)c(F)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1396876-60-0? |
| A: Chinese name of 1396876-60-0 is 1396876-60-0. |
| Q: What is the SMILES notation of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide? |
| A: SMILES notation of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide is O=C(NCC1CCN(C(=O)c2ccncc2)CC1)c1ccc(F)c(F)c1. |
| Q: What is the CAS number of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide? |
| A: CAS number of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide is 1396876-60-0. |
| Q: What is the English name of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide? |
| A: The English name of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide is 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide. |
| Q: What is the InChIKey of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide? |
| A: InChIKey of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide is RTXYUBVURPPLHO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide? |
| A: Molecular formula of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide is C19H19F2N3O2. |
| Q: What is the molecular weight of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide? |
| A: Molecular weight of 3,4-difluoro-N-((1-isonicotinoylpiperidin-4-yl)methyl)benzamide is 359.4. |