alpha-[[[4-(2-Indolizinyl)phenyl]amino]methyl]-2-nitro-1H-imidazole-1-ethanol structure
|
Common Name | alpha-[[[4-(2-Indolizinyl)phenyl]amino]methyl]-2-nitro-1H-imidazole-1-ethanol | ||
|---|---|---|---|---|
| CAS Number | 139705-75-2 | Molecular Weight | 377.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | alpha-[[[4-(2-Indolizinyl)phenyl]amino]methyl]-2-nitro-1H-imidazole-1-ethanol |
|---|
| Molecular Formula | C20H19N5O3 |
|---|---|
| Molecular Weight | 377.4 |
| InChIKey | POFITUHRFUJMDU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1nccn1CC(O)CNc1ccc(-c2cc3ccccn3c2)cc1 |
|
Name: Maximum accumulation of fluorescent metabolites in V79 379A chinese hamster cells aft...
Source: ChEMBL
Target: N/A
External Id: CHEMBL872524
|
|
Name: Cytofluorimetric analysis of V79 379A chinese hamster cells incubated under oxic cond...
Source: ChEMBL
Target: N/A
External Id: CHEMBL815240
|
|
Name: Cytofluorimetric analysis of V79 379A chinese hamster cells incubated under hypoxic c...
Source: ChEMBL
Target: N/A
External Id: CHEMBL815239
|