Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl)
Modify Date: 2025-11-06 17:16:18
Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) structure
|
Common Name | Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 1397187-23-3 | Molecular Weight | 267.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12Cl2O2S |
|---|---|
| Molecular Weight | 267.17 |
| InChIKey | KQXXNEQQJSOZRG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(CCCCl)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl)? |
| A: The English name of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) is Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl). |
| Q: What is the CAS number of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl)? |
| A: CAS number of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) is 1397187-23-3. |
| Q: What is the Chinese name of 1397187-23-3? |
| A: Chinese name of 1397187-23-3 is 1397187-23-3. |
| Q: What is the molecular formula of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl)? |
| A: Molecular formula of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) is C10H12Cl2O2S. |
| Q: What is the InChIKey of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl)? |
| A: InChIKey of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) is KQXXNEQQJSOZRG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl)? |
| A: Molecular weight of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) is 267.17. |
| Q: What is the SMILES notation of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl)? |
| A: SMILES notation of Benzene, 2-chloro-1-(3-chloropropyl)-4-(methylsulfonyl) is CS(=O)(=O)c1ccc(CCCCl)c(Cl)c1. |