CID 53417290
Modify Date: 2025-08-27 23:59:42
CID 53417290 structure
|
Common Name | CID 53417290 | ||
|---|---|---|---|---|
| CAS Number | 1397194-25-0 | Molecular Weight | 261.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 53417290 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18F3NO |
|---|---|
| Molecular Weight | 261.28 |
| InChIKey | YOMQPHDBRPVMKO-UHFFFAOYSA-N |
| SMILES | COc1ccc(NCC(C)(C)C)cc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of CID 53417290? |
| A: InChIKey of CID 53417290 is YOMQPHDBRPVMKO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of CID 53417290? |
| A: Molecular formula of CID 53417290 is C13H18F3NO. |
| Q: What is the English name of CID 53417290? |
| A: The English name of CID 53417290 is CID 53417290. |
| Q: What is the CAS number of CID 53417290? |
| A: CAS number of CID 53417290 is 1397194-25-0. |
| Q: What is the SMILES notation of CID 53417290? |
| A: SMILES notation of CID 53417290 is COc1ccc(NCC(C)(C)C)cc1C(F)(F)F. |
| Q: What is the molecular weight of CID 53417290? |
| A: Molecular weight of CID 53417290 is 261.28. |
| Q: What is the Chinese name of 1397194-25-0? |
| A: Chinese name of 1397194-25-0 is 1397194-25-0. |