11-Acetic acid-azaartemisinin
Modify Date: 2025-09-06 11:14:53
11-Acetic acid-azaartemisinin structure
|
Common Name | 11-Acetic acid-azaartemisinin | ||
|---|---|---|---|---|
| CAS Number | 139727-75-6 | Molecular Weight | 325.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 11-Acetic acid-azaartemisinin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23NO6 |
|---|---|
| Molecular Weight | 325.36 |
| InChIKey | MHZGAEVJROPLJS-UHFFFAOYSA-N |
| SMILES | CC1CCC2CC(=O)N(CC(=O)O)C3OC4(C)CCC1C23OO4 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 11-Acetic acid-azaartemisinin? |
| A: The English name of 11-Acetic acid-azaartemisinin is 11-Acetic acid-azaartemisinin. |
| Q: What is the molecular weight of 11-Acetic acid-azaartemisinin? |
| A: Molecular weight of 11-Acetic acid-azaartemisinin is 325.36. |
| Q: What is the InChIKey of 11-Acetic acid-azaartemisinin? |
| A: InChIKey of 11-Acetic acid-azaartemisinin is MHZGAEVJROPLJS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 11-Acetic acid-azaartemisinin? |
| A: CAS number of 11-Acetic acid-azaartemisinin is 139727-75-6. |
| Q: What is the SMILES notation of 11-Acetic acid-azaartemisinin? |
| A: SMILES notation of 11-Acetic acid-azaartemisinin is CC1CCC2CC(=O)N(CC(=O)O)C3OC4(C)CCC1C23OO4. |
| Q: What is the Chinese name of 139727-75-6? |
| A: Chinese name of 139727-75-6 is 139727-75-6. |
| Q: What is the molecular formula of 11-Acetic acid-azaartemisinin? |
| A: Molecular formula of 11-Acetic acid-azaartemisinin is C16H23NO6. |