crosatoside B
Modify Date: 2026-07-31 23:54:27
crosatoside B structure
|
Common Name | crosatoside B | ||
|---|---|---|---|---|
| CAS Number | 139742-28-2 | Molecular Weight | 446.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | crosatoside B |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H30O11 |
|---|---|
| Molecular Weight | 446.4 |
| InChIKey | BMZAMCOQJLZXCY-QLDOSHOCSA-N |
| SMILES | CC1OC(OC2C(OCCc3ccc(O)cc3)OC(CO)C(O)C2O)C(O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of crosatoside B? |
| A: The English name of crosatoside B is crosatoside B. |
| Q: What is the molecular formula of crosatoside B? |
| A: Molecular formula of crosatoside B is C20H30O11. |
| Q: What is the Chinese name of 139742-28-2? |
| A: Chinese name of 139742-28-2 is 139742-28-2. |
| Q: What is the CAS number of crosatoside B? |
| A: CAS number of crosatoside B is 139742-28-2. |
| Q: What is the SMILES notation of crosatoside B? |
| A: SMILES notation of crosatoside B is CC1OC(OC2C(OCCc3ccc(O)cc3)OC(CO)C(O)C2O)C(O)C(O)C1O. |
| Q: What is the InChIKey of crosatoside B? |
| A: InChIKey of crosatoside B is BMZAMCOQJLZXCY-QLDOSHOCSA-N. |
| Q: What is the molecular weight of crosatoside B? |
| A: Molecular weight of crosatoside B is 446.4. |