Benzenemethanol,4-[(dimethylamino)methyl]-a,a-diphenyl- structure
|
Common Name | Benzenemethanol,4-[(dimethylamino)methyl]-a,a-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 13991-00-9 | Molecular Weight | 317.42400 | |
| Density | 1.106g/cm3 | Boiling Point | 450.9ºC at 760mmHg | |
| Molecular Formula | C22H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.6ºC | |
| Name | [4-[(dimethylamino)methyl]phenyl]-diphenylmethanol |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 450.9ºC at 760mmHg |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.42400 |
| Flash Point | 174.6ºC |
| Exact Mass | 317.17800 |
| PSA | 23.47000 |
| LogP | 4.03240 |
| Vapour Pressure | 6.44E-09mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | HOBVSZKHPXZFQF-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1ccc(C(O)(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |