Urea, 1- (2-chloroethyl)-1-nitroso-3-(.alpha.,.alpha., .alpha.-trifluoro-p-tolyl)- structure
|
Common Name | Urea, 1- (2-chloroethyl)-1-nitroso-3-(.alpha.,.alpha., .alpha.-trifluoro-p-tolyl)- | ||
|---|---|---|---|---|
| CAS Number | 13991-76-9 | Molecular Weight | 295.64600 | |
| Density | 1.45g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9ClF3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-1-nitroso-3-[4-(trifluoromethyl)phenyl]urea |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Molecular Formula | C10H9ClF3N3O2 |
| Molecular Weight | 295.64600 |
| Exact Mass | 295.03400 |
| PSA | 61.77000 |
| LogP | 3.53250 |
| Index of Refraction | 1.527 |
| InChIKey | XNFVUJQRDLTCNW-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |