3-amino-9-bromo-5,6-dihydro-4H-benzo[f]quinazolin-1-one structure
|
Common Name | 3-amino-9-bromo-5,6-dihydro-4H-benzo[f]quinazolin-1-one | ||
|---|---|---|---|---|
| CAS Number | 139986-38-2 | Molecular Weight | 292.13100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-9-bromo-5,6-dihydro-4H-benzo[f]quinazolin-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10BrN3O |
|---|---|
| Molecular Weight | 292.13100 |
| Exact Mass | 291.00100 |
| PSA | 72.76000 |
| LogP | 2.22260 |
| InChIKey | JJPNUYHDMXFJIO-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(c(=O)[nH]1)-c1cc(Br)ccc1CC2 |
|
~51%
3-amino-9-bromo... CAS#:139986-38-2 |
| Literature: THE WELLCOME FOUNDATION LIMITED Patent: EP1199307 A1, 2002 ; Location in patent: Page 15 ; |
|
~%
3-amino-9-bromo... CAS#:139986-38-2 |
| Literature: Pendergast; Johnson; Dickerson; Dev; Duch; Ferone; Hall; Humphreys; Kelly; Wilson Journal of Medicinal Chemistry, 1993 , vol. 36, # 16 p. 2279 - 2291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibition against thymidylate synthase (TS) in Candida albicans
Source: ChEMBL
Target: Thymidylate synthase
External Id: CHEMBL883513
|
|
Name: Inhibition against thymidylate synthase (TS) in calf thymus
Source: ChEMBL
Target: Thymidylate synthase
External Id: CHEMBL816054
|
|
Name: Inhibition of the growth of the human tumor cell line SW480 (colon adenocarcinoma)
Source: ChEMBL
Target: SW480
External Id: CHEMBL805255
|
|
Name: Inhibition against thymidylate synthase (TS) in Escherichia coli
Source: ChEMBL
Target: Thymidylate synthase
External Id: CHEMBL812308
|
| 3-amino-9-bromo-5,6-dihydrobenzo[f]quinazolin-1(2H)-one |
| Benzo[f]quinazolin-1(2H)-one,3-amino-9-bromo-5,6-dihydro |