9-Octadecenoic acid,12-(acetyloxy)-, butyl ester, (9Z,12R)-
Modify Date: 2024-01-02 10:34:01
9-Octadecenoic acid,12-(acetyloxy)-, butyl ester, (9Z,12R)- structure
|
Common Name | 9-Octadecenoic acid,12-(acetyloxy)-, butyl ester, (9Z,12R)- | ||
|---|---|---|---|---|
| CAS Number | 140-04-5 | Molecular Weight | 396.60400 | |
| Density | 0.931 g/cm3 | Boiling Point | 468.7ºC at 760 mmHg | |
| Molecular Formula | C24H44O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 219.4ºC | |
| Name | butyl acetyl ricinoleate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.931 g/cm3 |
|---|---|
| Boiling Point | 468.7ºC at 760 mmHg |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.60400 |
| Flash Point | 219.4ºC |
| Exact Mass | 396.32400 |
| PSA | 52.60000 |
| LogP | 6.90880 |
| Vapour Pressure | 5.86E-09mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | BEWFIPLBFJGWSR-AONZOJHOSA-N |
| SMILES | CCCCCCC(CC=CCCCCCCCC(=O)OCCCC)OC(C)=O |
| HS Code | 2918990090 |
|---|
|
~%
9-Octadecenoic ... CAS#:140-04-5 |
| Literature: Rutowski; Ostroumowa Promysl. org. Chim.Chem.Abstr., 1939 , vol. 6, p. 239,240 Promysl. org. Chim.Chem.Abstr., 1940 , p. 2332 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetylricinoleicacidbutylester |
| EINECS 205-393-4 |
| O-Acetyl-ricinolsaeure-butylester |
| n-butyl acetylricinoleate |
| Butyl-O-acetylricinoleat |
| BUTYL O-ACETYLRICINOLEATE |