4-decylbenzenesulfonic acid
4-decylbenzenesulfonic acid structure
|
Common Name | 4-decylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 140-60-3 | Molecular Weight | 298.44100 | |
| Density | 1.077g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H26O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-decylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.077g/cm3 |
|---|---|
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.44100 |
| Exact Mass | 298.16000 |
| PSA | 62.75000 |
| LogP | 5.69730 |
| Index of Refraction | 1.513 |
| InChIKey | UASQKKHYUPBQJR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCc1ccc(S(=O)(=O)O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904100000 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:104-72-3
CAS#:108-86-1
CAS#:112-29-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-N-Decylbenzenesulfonate |
| Benzenesulfonic acid,4-decyl |
| 4-decyl-benzenesulfonic acid |
| 4-Decyl-benzolsulfonsaeure-(1) |
| 4-Decyl-benzolsulfonsaeure |
| Benzenesulfonic acid,p-decyl |
| p-Decylbenzenesulphonic acid |
| p-n-Decylbenzolsulfonsaeure |
| EINECS 205-422-0 |
| p-decylbenzenesulfonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-decylbenzenesulfonic acid have? |
| A: English synonyms of 4-decylbenzenesulfonic acid: p-N-Decylbenzenesulfonate, Benzenesulfonic acid,4-decyl, 4-decyl-benzenesulfonic acid, 4-Decyl-benzolsulfonsaeure-(1), 4-Decyl-benzolsulfonsaeure, Benzenesulfonic acid,p-decyl, p-Decylbenzenesulphonic acid, p-n-Decylbenzolsulfonsaeure, EINECS 205-422-0, p-decylbenzenesulfonic acid. |
| Q: What is the molecular formula of 4-decylbenzenesulfonic acid? |
| A: Molecular formula of 4-decylbenzenesulfonic acid is C16H26O3S. |
| Q: What is the SMILES notation of 4-decylbenzenesulfonic acid? |
| A: SMILES notation of 4-decylbenzenesulfonic acid is CCCCCCCCCCc1ccc(S(=O)(=O)O)cc1. |
| Q: What is the InChIKey of 4-decylbenzenesulfonic acid? |
| A: InChIKey of 4-decylbenzenesulfonic acid is UASQKKHYUPBQJR-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 4-decylbenzenesulfonic acid? |
| A: Related upstream materials(CAS) of 4-decylbenzenesulfonic acid: 104-72-3;108-86-1;112-29-8. |
| Q: What is the CAS number of 4-decylbenzenesulfonic acid? |
| A: CAS number of 4-decylbenzenesulfonic acid is 140-60-3. |
| Q: What is the LogP of 4-decylbenzenesulfonic acid? |
| A: LogP of 4-decylbenzenesulfonic acid is 5.69730. |
| Q: What is the English name of 4-decylbenzenesulfonic acid? |
| A: The English name of 4-decylbenzenesulfonic acid is 4-decylbenzenesulfonic acid. |
| Q: What is the molecular weight of 4-decylbenzenesulfonic acid? |
| A: Molecular weight of 4-decylbenzenesulfonic acid is 298.44100. |
| Q: What is the polar surface area (PSA) of 4-decylbenzenesulfonic acid? |
| A: Polar surface area (PSA) of 4-decylbenzenesulfonic acid is 62.75000. |