1H-Indole-2-carboxylicacid, 4,5,6,7-tetrahydro-1,3-dimethyl-4-oxo-, ethyl ester structure
|
Common Name | 1H-Indole-2-carboxylicacid, 4,5,6,7-tetrahydro-1,3-dimethyl-4-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 14006-82-7 | Molecular Weight | 235.27900 | |
| Density | 1.21g/cm3 | Boiling Point | 403ºC at 760mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.5ºC | |
| Name | ethyl 1,3-dimethyl-4-oxo-6,7-dihydro-5H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 403ºC at 760mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.27900 |
| Flash Point | 197.5ºC |
| Exact Mass | 235.12100 |
| PSA | 48.30000 |
| LogP | 2.02920 |
| Vapour Pressure | 1.06E-06mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | AISFUVKQJOHZDN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)c2c(n1C)CCCC2=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 1,3-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| 2-carbethoxy-1,3-dimethyl-4-oxo-4,5,6,7-tetrahydroindole |
| 1,3-dimethyl-2-ethoxycarbonyl-1,5,6,7-tetrahydro-4H-indol-4-one |
| 1,3-dimethyl-4-oxo-4,5,6,7-tetrahydro-indole-2-carboxylic acid ethyl ester |