2-(diethylamino)ethyl 2-phenylbutanoate structure
|
Common Name | 2-(diethylamino)ethyl 2-phenylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 14007-64-8 | Molecular Weight | 263.37500 | |
| Density | 0.99g/cm3 | Boiling Point | 348ºC at 760mmHg | |
| Molecular Formula | C16H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.3ºC | |
| Name | 2-(diethylamino)ethyl 2-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 348ºC at 760mmHg |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.37500 |
| Flash Point | 110.3ºC |
| Exact Mass | 263.18900 |
| PSA | 29.54000 |
| LogP | 3.06520 |
| Vapour Pressure | 5.18E-05mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | CKWHSYRZDLWQFV-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)OCCN(CC)CC)c1ccccc1 |
| HS Code | 2922199090 |
|---|
|
~%
2-(diethylamino... CAS#:14007-64-8 |
| Literature: Farmaco, Edizione Scientifica, , vol. 11, p. 540,545 |
|
~%
2-(diethylamino... CAS#:14007-64-8 |
| Literature: US2219796 , ; |
|
~%
2-(diethylamino... CAS#:14007-64-8 |
| Literature: US2219796 , ; |
|
~%
2-(diethylamino... CAS#:14007-64-8 |
| Literature: Farmaco, Edizione Scientifica, , vol. 12, p. 836,844 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butetamate |
| Butethamate |