{[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride
Modify Date: 2025-11-03 15:46:15
![{[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride Structure](https://www.chemsrc.com/extcaspic/066/1401425-34-0.png)
{[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride structure
|
Common Name | {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1401425-34-0 | Molecular Weight | 277.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14Cl2N2S |
|---|---|
| Molecular Weight | 277.2 |
| InChIKey | WRMQSCRDSDBBFJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ncc(CN)s2)cc1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride? |
| A: The English name of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride is {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride. |
| Q: What is the CAS number of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride? |
| A: CAS number of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride is 1401425-34-0. |
| Q: What is the Chinese name of 1401425-34-0? |
| A: Chinese name of 1401425-34-0 is 1401425-34-0. |
| Q: What is the InChIKey of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride? |
| A: InChIKey of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride is WRMQSCRDSDBBFJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride? |
| A: SMILES notation of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride is Cc1ccc(-c2ncc(CN)s2)cc1.Cl.Cl. |
| Q: What is the molecular weight of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride? |
| A: Molecular weight of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride is 277.2. |
| Q: What is the molecular formula of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride? |
| A: Molecular formula of {[2-(4-Methylphenyl)-1,3-thiazol-5-yl]methyl}amine dihydrochloride is C11H14Cl2N2S. |