valproyl-adenylic acid structure
|
Common Name | valproyl-adenylic acid | ||
|---|---|---|---|---|
| CAS Number | 140233-88-1 | Molecular Weight | 473.41700 | |
| Density | 1.67g/cm3 | Boiling Point | 732.7ºC at 760 mmHg | |
| Molecular Formula | C18H28N5O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.9ºC | |
| Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 2-propylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 732.7ºC at 760 mmHg |
| Molecular Formula | C18H28N5O8P |
| Molecular Weight | 473.41700 |
| Flash Point | 396.9ºC |
| Exact Mass | 473.16800 |
| PSA | 201.95000 |
| LogP | 1.48550 |
| Vapour Pressure | 1.54E-22mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | WIBHCYGIEDIFDO-LSCFUAHRSA-N |
| SMILES | CCCC(CCC)C(=O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| Valproyl-adenylic acid |
| 5'-Adenylic acid,monoanhydride with 2-propylpentanoic acid |
| Valproyl-amp |