2,4-Dinitro-3'-methoxydiphenylamine structure
|
Common Name | 2,4-Dinitro-3'-methoxydiphenylamine | ||
|---|---|---|---|---|
| CAS Number | 14038-09-6 | Molecular Weight | 289.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-methoxyphenyl)-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11N3O5 |
|---|---|
| Molecular Weight | 289.24400 |
| Exact Mass | 289.07000 |
| PSA | 112.90000 |
| LogP | 4.37460 |
| InChIKey | WQUJWAFXGOBBCX-UHFFFAOYSA-N |
| SMILES | COc1cccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-methoxy-2,4-dinitrodiphenylamine |
| 3-(2.4-Dinitro-anilino)-phenol-methylaether |
| 2.4-Dinitro-3'-methoxy-diphenylamin |
| (2.4-Dinitro-phenyl)-m-anisidin |
| (2,4-dinitro-phenyl)-(3-methoxy-phenyl)-amine |
| Benzenamine,N-(3-methoxyphenyl)-2,4-dinitro |
| (2,4-Dinitro-phenyl)-(3-methoxy-phenyl)-amin |