9-fluoro-6-methylpyrido[2,3-b][1,5]benzoxazepin-5-one structure
|
Common Name | 9-fluoro-6-methylpyrido[2,3-b][1,5]benzoxazepin-5-one | ||
|---|---|---|---|---|
| CAS Number | 140413-12-3 | Molecular Weight | 244.22100 | |
| Density | 1.358g/cm3 | Boiling Point | 418.6ºC at 760mmHg | |
| Molecular Formula | C13H9FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9ºC | |
| Name | 9-fluoro-6-methylpyrido[2,3-b][1,5]benzoxazepin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760mmHg |
| Molecular Formula | C13H9FN2O2 |
| Molecular Weight | 244.22100 |
| Flash Point | 206.9ºC |
| Exact Mass | 244.06500 |
| PSA | 42.43000 |
| LogP | 2.66800 |
| Vapour Pressure | 3.25E-07mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | MOHYLQTWQIHBTI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2cccnc2Oc2cc(F)ccc21 |
|
~%
9-fluoro-6-meth... CAS#:140413-12-3 |
| Literature: Klunder, Janice M.; Hargrave, Karl D.; West, MaryAnn; Cullen, Ernest; Pal, Kollol; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 10 p. 1887 - 1897 |
|
~%
9-fluoro-6-meth... CAS#:140413-12-3 |
| Literature: Klunder, Janice M.; Hargrave, Karl D.; West, MaryAnn; Cullen, Ernest; Pal, Kollol; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 10 p. 1887 - 1897 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Fluoro-6-methyl-pyrido(2,3-b)(1,5)benzoxazepin-5(6H)-one |
| Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one,9-fluoro-6-methyl |
| 9F-6Me-PBOA-5one |