2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid
Modify Date: 2026-08-14 15:00:42
2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid structure
|
Common Name | 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1404958-72-0 | Molecular Weight | 302.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13Cl2NO3 |
|---|---|
| Molecular Weight | 302.15 |
| InChIKey | IYKHOJNIDSGJFE-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1CC1)C(C(=O)O)c1ccc(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid? |
| A: InChIKey of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid is IYKHOJNIDSGJFE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid? |
| A: Molecular formula of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid is C13H13Cl2NO3. |
| Q: What is the molecular weight of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid? |
| A: Molecular weight of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid is 302.15. |
| Q: What is the SMILES notation of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid? |
| A: SMILES notation of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid is CC(=O)N(C1CC1)C(C(=O)O)c1ccc(Cl)cc1Cl. |
| Q: What is the CAS number of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid? |
| A: CAS number of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid is 1404958-72-0. |
| Q: What is the English name of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid? |
| A: The English name of 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid is 2-(N-cyclopropylacetamido)-2-(2,4-dichlorophenyl)acetic acid. |
| Q: What is the Chinese name of 1404958-72-0? |
| A: Chinese name of 1404958-72-0 is 1404958-72-0. |