N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-1-phenylethanimine structure
|
Common Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-1-phenylethanimine | ||
|---|---|---|---|---|
| CAS Number | 140616-37-1 | Molecular Weight | 362.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-1-phenylethanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20BrNO2 |
|---|---|
| Molecular Weight | 362.26100 |
| Exact Mass | 361.06800 |
| PSA | 30.82000 |
| LogP | 4.51800 |
| InChIKey | PMDHJDFHPTWXRU-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c(CCN=C(C)c2ccccc2)cc1OC |
|
~%
N-[2-(2-bromo-4... CAS#:140616-37-1 |
| Literature: Viswanathan, Rajesh; Prabhakaran, Erode N.; Plotkin, Michael A.; Johnston, Jeffrey N. Journal of the American Chemical Society, 2003 , vol. 125, # 1 p. 163 - 168 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzeneethanamine,2-bromo-4,5-dimethoxy-N-(1-phenylethylidene) |