Ser-Ala-SAP-IIB structure
|
Common Name | Ser-Ala-SAP-IIB | ||
|---|---|---|---|---|
| CAS Number | 140653-27-6 | Molecular Weight | 1046.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H71N13O14S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ser-Ala-SAP-IIBSer-Ala-alloresact is a sperm activating peptide (SAP). The peptides released from eggs of marine invertebrates play a central role in fertilization[1][2]. |
| Name | ser-ala-alloresact |
|---|---|
| Synonym | More Synonyms |
| Description | Ser-Ala-alloresact is a sperm activating peptide (SAP). The peptides released from eggs of marine invertebrates play a central role in fertilization[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Sperm-activating peptides involves in the regulation of ion fluxes, signal transduction (cGMP signaling) and motility[3]. |
| Molecular Formula | C42H71N13O14S2 |
|---|---|
| Molecular Weight | 1046.22000 |
| Exact Mass | 1045.47000 |
| PSA | 485.47000 |
| InChIKey | CSUVIBOHPJFWDA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(N)CO)C(=O)NC1CSSCC(C(=O)NC(C(=O)O)C(C)C)NC(=O)C(CC(N)=O)NC(=O)CNC(=O)CNC(=O)C2CCCN2C1=O |
| WGK Germany | 3 |
|---|
| ser-ala-sperm-activating peptides-iib |
| sperm activating peptide |
| ser-ala-sap-iib |
| h-ser-ala-lys-leu-cys-pro-gly-gly-asn-cys-val-oh |
| ser-ala-lys-leu-cys-pro-gly-gly-asn-cys-val sea urchin |
| ser-ala-lys-leu-cys-pro-gly-gly-asn-cys-val |
| sperm activating peptide,sea urchin |